C13H21N3O4 — CID 81162871
2-[1-[[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]methyl]cyclobutyl]acetic acid (PubChem CID 81162871) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[1-[[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 81162871 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[1-[[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]methyl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(CNC(=O)NCC(=O)NC2CC2)CCC1 |
| InChI | InChI=1S/C13H21N3O4/c17-10(16-9-2-3-9)7-14-12(20)15-8-13(4-1-5-13)6-11(18)19/h9H,1-8H2,(H,16,17)(H,18,19)(H2,14,15,20) |
| InChIKey | DUKBYTRNXMBRQI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |