About 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene
2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene (PubChem CID 81163831) has the molecular formula C19H27BrS
and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene.
Molecular Properties
| Compound Name | 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene |
| PubChem CID | 81163831 |
| Molecular Formula | C19H27BrS |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene |
| SMILES | Cc1cc(C)c(C(Br)C23CC4CC(C)(CC(C)(C4)C2)C3)s1 |
| InChI | InChI=1S/C19H27BrS/c1-12-5-13(2)21-15(12)16(20)19-8-14-6-17(3,10-19)9-18(4,7-14)11-19/h5,14,16H,6-11H2,1-4H3 |
| InChIKey | HNXSSBHZZKUGSA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene?
The IUPAC name of 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene (CID 81163831) is 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene.
What is the SMILES notation for 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene?
The canonical SMILES for 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene is Cc1cc(C)c(C(Br)C23CC4CC(C)(CC(C)(C4)C2)C3)s1.
What is the InChIKey of 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene?
The InChIKey is HNXSSBHZZKUGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27BrS/c1-12-5-13(2)21-15(12)16(20)19-8-14-6-17(3,10-19)9-18(4,7-14)11-19/h5,14,16H,6-11H2,1-4H3.
What are the key properties of 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene?
2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene has a molecular weight of 367.40 g/mol, XLogP of 6.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-3,5-dimethylthiophene is sourced from PubChem (CID 81163831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).