C16H19NO4 — CID 81164875
2-[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclobutyl]acetic acid (PubChem CID 81164875) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 81164875 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)methyl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(CN2C(=O)C3C4C=CC(C4)C3C2=O)CCC1 |
| InChI | InChI=1S/C16H19NO4/c18-11(19)7-16(4-1-5-16)8-17-14(20)12-9-2-3-10(6-9)13(12)15(17)21/h2-3,9-10,12-13H,1,4-8H2,(H,18,19) |
| InChIKey | KMLKIHLEHFKNIU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|