C14H23ClN2O2 — CID 81166238
4-(2-aminoethyl)-2-chloro-N,N-bis(2-methoxyethyl)aniline (PubChem CID 81166238) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-chloro-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 4-(2-aminoethyl)-2-chloro-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 81166238 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-(2-aminoethyl)-2-chloro-N,N-bis(2-methoxyethyl)aniline |
| SMILES | COCCN(CCOC)c1ccc(CCN)cc1Cl |
| InChI | InChI=1S/C14H23ClN2O2/c1-18-9-7-17(8-10-19-2)14-4-3-12(5-6-16)11-13(14)15/h3-4,11H,5-10,16H2,1-2H3 |
| InChIKey | QIFKYVJYLRBXKK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |