C8H7F5N4O2 — CID 81166870
1-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid (PubChem CID 81166870) has the molecular formula C8H7F5N4O2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81166870 |
| Molecular Formula | C8H7F5N4O2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(n2nnnc2C(F)(F)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C8H7F5N4O2/c9-7(10,8(11,12)13)4-14-15-16-17(4)6(5(18)19)2-1-3-6/h1-3H2,(H,18,19) |
| InChIKey | BWLSREAFOKBTHS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|