About 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane]
6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] (PubChem CID 81166977) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane].
Molecular Properties
| Compound Name | 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] |
| PubChem CID | 81166977 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] |
| SMILES | Cc1ccc2c(c1)NC1(CCC1)CN2 |
| InChI | InChI=1S/C12H16N2/c1-9-3-4-10-11(7-9)14-12(8-13-10)5-2-6-12/h3-4,7,13-14H,2,5-6,8H2,1H3 |
| InChIKey | ABCXOZDVDQUZDL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane]?
The IUPAC name of 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] (CID 81166977) is 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane].
What is the SMILES notation for 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane]?
The canonical SMILES for 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] is Cc1ccc2c(c1)NC1(CCC1)CN2.
What is the InChIKey of 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane]?
The InChIKey is ABCXOZDVDQUZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-9-3-4-10-11(7-9)14-12(8-13-10)5-2-6-12/h3-4,7,13-14H,2,5-6,8H2,1H3.
What are the key properties of 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane]?
6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] has a molecular weight of 188.27 g/mol, XLogP of 2.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylspiro[2,4-dihydro-1H-quinoxaline-3,1'-cyclobutane] is sourced from PubChem (CID 81166977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).