C13H16N2O3 — CID 81167287
1-[(3-carbamoylphenyl)methylamino]cyclobutane-1-carboxylic acid (PubChem CID 81167287) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-[(3-carbamoylphenyl)methylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(3-carbamoylphenyl)methylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81167287 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[(3-carbamoylphenyl)methylamino]cyclobutane-1-carboxylic acid |
| SMILES | NC(=O)c1cccc(CNC2(C(=O)O)CCC2)c1 |
| InChI | InChI=1S/C13H16N2O3/c14-11(16)10-4-1-3-9(7-10)8-15-13(12(17)18)5-2-6-13/h1,3-4,7,15H,2,5-6,8H2,(H2,14,16)(H,17,18) |
| InChIKey | KLIRHIXHPCYAQH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |