About 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione
8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione (PubChem CID 81167346) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione.
Molecular Properties
| Compound Name | 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione |
| PubChem CID | 81167346 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione |
| SMILES | O=C1CC2(CCC2)CNC(=O)N1C1CCOC1 |
| InChI | InChI=1S/C12H18N2O3/c15-10-6-12(3-1-4-12)8-13-11(16)14(10)9-2-5-17-7-9/h9H,1-8H2,(H,13,16) |
| InChIKey | CKABTYCQRBOWCT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione?
The IUPAC name of 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione (CID 81167346) is 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione.
What is the SMILES notation for 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione?
The canonical SMILES for 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione is O=C1CC2(CCC2)CNC(=O)N1C1CCOC1.
What is the InChIKey of 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione?
The InChIKey is CKABTYCQRBOWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c15-10-6-12(3-1-4-12)8-13-11(16)14(10)9-2-5-17-7-9/h9H,1-8H2,(H,13,16).
What are the key properties of 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione?
8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione has a molecular weight of 238.29 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(oxolan-3-yl)-6,8-diazaspiro[3.6]decane-7,9-dione is sourced from PubChem (CID 81167346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).