1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid

C9H12N2O2S — CID 81167359

IUPAC1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid
SMILESO=C(O)C1(NCc2cscn2)CCC1
InChIInChI=1S/C9H12N2O2S/c12-8(13)9(2-1-3-9)11-4-7-5-14-6-10-7/h5-6,11H,1-4H2,(H,12,13)
InChIKeyMARVQTQGORYIEH-UHFFFAOYSA-N
MW212.27 g/mol
LogP1.24
Rot. Bonds4

About 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid

1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid (PubChem CID 81167359) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid
PubChem CID81167359
Molecular FormulaC9H12N2O2S
Molecular Weight212.27 g/mol
Exact Mass212.06
IUPAC Name1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid
SMILESO=C(O)C1(NCc2cscn2)CCC1
InChIInChI=1S/C9H12N2O2S/c12-8(13)9(2-1-3-9)11-4-7-5-14-6-10-7/h5-6,11H,1-4H2,(H,12,13)
InChIKeyMARVQTQGORYIEH-UHFFFAOYSA-N
XLogP1.24
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.27
LogP ≤ 51.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid (CID 81167359) is 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid is O=C(O)C1(NCc2cscn2)CCC1.
What is the InChIKey of 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid?
The InChIKey is MARVQTQGORYIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c12-8(13)9(2-1-3-9)11-4-7-5-14-6-10-7/h5-6,11H,1-4H2,(H,12,13).
What are the key properties of 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid?
1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-4-ylmethylamino)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 81167359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).