C8H8F4N4O2 — CID 81167400
1-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid (PubChem CID 81167400) has the molecular formula C8H8F4N4O2 and a molecular weight of 268.17 g/mol. Its IUPAC name is 1-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81167400 |
| Molecular Formula | C8H8F4N4O2 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(n2nnnc2C(F)(F)C(F)F)CCC1 |
| InChI | InChI=1S/C8H8F4N4O2/c9-4(10)8(11,12)5-13-14-15-16(5)7(6(17)18)2-1-3-7/h4H,1-3H2,(H,17,18) |
| InChIKey | UICAHIXIPUEHOF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|