About 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine
2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine (PubChem CID 81170404) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine |
| PubChem CID | 81170404 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine |
| SMILES | NCC1CCCCC1NCc1ccon1 |
| InChI | InChI=1S/C11H19N3O/c12-7-9-3-1-2-4-11(9)13-8-10-5-6-15-14-10/h5-6,9,11,13H,1-4,7-8,12H2 |
| InChIKey | HTIHLHMBLAMXBV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine?
The IUPAC name of 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine (CID 81170404) is 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine.
What is the SMILES notation for 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine?
The canonical SMILES for 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine is NCC1CCCCC1NCc1ccon1.
What is the InChIKey of 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine?
The InChIKey is HTIHLHMBLAMXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c12-7-9-3-1-2-4-11(9)13-8-10-5-6-15-14-10/h5-6,9,11,13H,1-4,7-8,12H2.
What are the key properties of 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine?
2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine has a molecular weight of 209.29 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N-(1,2-oxazol-3-ylmethyl)cyclohexan-1-amine is sourced from PubChem (CID 81170404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).