About 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide
2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide (PubChem CID 81171334) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide |
| PubChem CID | 81171334 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)NCc1ccon1 |
| InChI | InChI=1S/C11H18N4O2/c16-11(13-8-10-2-7-17-14-10)9-15-5-1-3-12-4-6-15/h2,7,12H,1,3-6,8-9H2,(H,13,16) |
| InChIKey | LKKPFAPTQPSQME-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide?
The IUPAC name of 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide (CID 81171334) is 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide is O=C(CN1CCCNCC1)NCc1ccon1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide?
The InChIKey is LKKPFAPTQPSQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c16-11(13-8-10-2-7-17-14-10)9-15-5-1-3-12-4-6-15/h2,7,12H,1,3-6,8-9H2,(H,13,16).
What are the key properties of 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide?
2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide has a molecular weight of 238.29 g/mol, XLogP of -0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-N-(1,2-oxazol-3-ylmethyl)acetamide is sourced from PubChem (CID 81171334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).