About 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine
5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 81173686) has the molecular formula C8H8FN5O
and a molecular weight of 209.18 g/mol. Its IUPAC name is 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine |
| PubChem CID | 81173686 |
| Molecular Formula | C8H8FN5O |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(F)c(NCc2ccon2)n1 |
| InChI | InChI=1S/C8H8FN5O/c9-6-4-12-8(10)13-7(6)11-3-5-1-2-15-14-5/h1-2,4H,3H2,(H3,10,11,12,13) |
| InChIKey | PCXSIRKEQILJQB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine (CID 81173686) is 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine is Nc1ncc(F)c(NCc2ccon2)n1.
What is the InChIKey of 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine?
The InChIKey is PCXSIRKEQILJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN5O/c9-6-4-12-8(10)13-7(6)11-3-5-1-2-15-14-5/h1-2,4H,3H2,(H3,10,11,12,13).
What are the key properties of 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine?
5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine has a molecular weight of 209.18 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-N-(1,2-oxazol-3-ylmethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 81173686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).