About 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile
1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 81173743) has the molecular formula C9H6N4O3
and a molecular weight of 218.17 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 81173743 |
| Molecular Formula | C9H6N4O3 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(Cc2ccon2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H6N4O3/c10-3-6-4-13(9(15)11-8(6)14)5-7-1-2-16-12-7/h1-2,4H,5H2,(H,11,14,15) |
| InChIKey | KBOHUQSAWJWVGZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile (CID 81173743) is 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile is N#Cc1cn(Cc2ccon2)c(=O)[nH]c1=O.
What is the InChIKey of 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is KBOHUQSAWJWVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O3/c10-3-6-4-13(9(15)11-8(6)14)5-7-1-2-16-12-7/h1-2,4H,5H2,(H,11,14,15).
What are the key properties of 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile?
1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 218.17 g/mol, XLogP of -0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-oxazol-3-ylmethyl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 81173743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).