C11H17N3O — CID 81173891
3-[(3-cyclopropylpiperazin-1-yl)methyl]-1,2-oxazole (PubChem CID 81173891) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-[(3-cyclopropylpiperazin-1-yl)methyl]-1,2-oxazole.
| Compound Name | 3-[(3-cyclopropylpiperazin-1-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 81173891 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-[(3-cyclopropylpiperazin-1-yl)methyl]-1,2-oxazole |
| SMILES | c1cc(CN2CCNC(C3CC3)C2)no1 |
| InChI | InChI=1S/C11H17N3O/c1-2-9(1)11-8-14(5-4-12-11)7-10-3-6-15-13-10/h3,6,9,11-12H,1-2,4-5,7-8H2 |
| InChIKey | SFYDNSYMECEAIJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |