C6H7N5OS — CID 81174060
3-amino-4-(1,2-oxazol-3-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 81174060) has the molecular formula C6H7N5OS and a molecular weight of 197.22 g/mol. Its IUPAC name is 3-amino-4-(1,2-oxazol-3-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-(1,2-oxazol-3-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 81174060 |
| Molecular Formula | C6H7N5OS |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 3-amino-4-(1,2-oxazol-3-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1Cc1ccon1 |
| InChI | InChI=1S/C6H7N5OS/c7-5-8-9-6(13)11(5)3-4-1-2-12-10-4/h1-2H,3H2,(H2,7,8)(H,9,13) |
| InChIKey | AKPYWPOBMALERP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|