C13H15BrClN3O2S — CID 81175587
2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylsulfonyl]-5-chloroaniline (PubChem CID 81175587) has the molecular formula C13H15BrClN3O2S and a molecular weight of 392.71 g/mol. Its IUPAC name is 2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylsulfonyl]-5-chloroaniline.
| Compound Name | 2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylsulfonyl]-5-chloroaniline |
|---|---|
| PubChem CID | 81175587 |
| Molecular Formula | C13H15BrClN3O2S |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylsulfonyl]-5-chloroaniline |
| SMILES | CCn1nc(C)c(Br)c1CS(=O)(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C13H15BrClN3O2S/c1-3-18-11(13(14)8(2)17-18)7-21(19,20)12-5-4-9(15)6-10(12)16/h4-6H,3,7,16H2,1-2H3 |
| InChIKey | KDIGZDFWZXZFPY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|