C8H8N2O3 — CID 81176806
1-(1,2-oxazol-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 81176806) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(1,2-oxazol-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 81176806 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 1-(1,2-oxazol-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1CCN(Cc2ccon2)C1=O |
| InChI | InChI=1S/C8H8N2O3/c11-7-1-3-10(8(7)12)5-6-2-4-13-9-6/h2,4H,1,3,5H2 |
| InChIKey | YVCVAPXLUVSQKV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|