C10H5F5N2O — CID 81177136
2,3,4,5,6-pentafluoro-N-(1,2-oxazol-3-ylmethyl)aniline (PubChem CID 81177136) has the molecular formula C10H5F5N2O and a molecular weight of 264.15 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(1,2-oxazol-3-ylmethyl)aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(1,2-oxazol-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 81177136 |
| Molecular Formula | C10H5F5N2O |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(1,2-oxazol-3-ylmethyl)aniline |
| SMILES | Fc1c(F)c(F)c(NCc2ccon2)c(F)c1F |
| InChI | InChI=1S/C10H5F5N2O/c11-5-6(12)8(14)10(9(15)7(5)13)16-3-4-1-2-18-17-4/h1-2,16H,3H2 |
| InChIKey | JUXSFQDQLNIKTQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|