About 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine
5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine (PubChem CID 81178042) has the molecular formula C11H8Cl2N4O
and a molecular weight of 283.12 g/mol. Its IUPAC name is 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine |
| PubChem CID | 81178042 |
| Molecular Formula | C11H8Cl2N4O |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)c(Cl)cc2n1Cc1ccon1 |
| InChI | InChI=1S/C11H8Cl2N4O/c12-7-3-9-10(4-8(7)13)17(11(14)15-9)5-6-1-2-18-16-6/h1-4H,5H2,(H2,14,15) |
| InChIKey | OPMVKVPCBMQZDS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
The IUPAC name of 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine (CID 81178042) is 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine.
What is the SMILES notation for 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
The canonical SMILES for 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine is Nc1nc2cc(Cl)c(Cl)cc2n1Cc1ccon1.
What is the InChIKey of 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
The InChIKey is OPMVKVPCBMQZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N4O/c12-7-3-9-10(4-8(7)13)17(11(14)15-9)5-6-1-2-18-16-6/h1-4H,5H2,(H2,14,15).
What are the key properties of 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine has a molecular weight of 283.12 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-1-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine is sourced from PubChem (CID 81178042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).