About 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline
2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline (PubChem CID 81181419) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline.
Molecular Properties
| Compound Name | 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline |
| PubChem CID | 81181419 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline |
| SMILES | Cc1cc(S(=O)(=O)Cc2ncnn2C)ccc1N |
| InChI | InChI=1S/C11H14N4O2S/c1-8-5-9(3-4-10(8)12)18(16,17)6-11-13-7-14-15(11)2/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | YIFSEALALUJGPK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline?
The IUPAC name of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline (CID 81181419) is 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline.
What is the SMILES notation for 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline?
The canonical SMILES for 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline is Cc1cc(S(=O)(=O)Cc2ncnn2C)ccc1N.
What is the InChIKey of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline?
The InChIKey is YIFSEALALUJGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c1-8-5-9(3-4-10(8)12)18(16,17)6-11-13-7-14-15(11)2/h3-5,7H,6,12H2,1-2H3.
What are the key properties of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline?
2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline has a molecular weight of 266.33 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylsulfonyl]aniline is sourced from PubChem (CID 81181419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).