C10H13ClN2O3S — CID 81181815
3-(4-amino-2-chlorophenyl)sulfonyl-2-methylpropanamide (PubChem CID 81181815) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 3-(4-amino-2-chlorophenyl)sulfonyl-2-methylpropanamide.
| Compound Name | 3-(4-amino-2-chlorophenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 81181815 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-(4-amino-2-chlorophenyl)sulfonyl-2-methylpropanamide |
| SMILES | CC(CS(=O)(=O)c1ccc(N)cc1Cl)C(N)=O |
| InChI | InChI=1S/C10H13ClN2O3S/c1-6(10(13)14)5-17(15,16)9-3-2-7(12)4-8(9)11/h2-4,6H,5,12H2,1H3,(H2,13,14) |
| InChIKey | UCSFNJRTFPDKLW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|