About 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline
4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline (PubChem CID 81184624) has the molecular formula C15H21N3O2S
and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline.
Molecular Properties
| Compound Name | 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline |
| PubChem CID | 81184624 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline |
| SMILES | CCc1cc(CS(=O)(=O)c2ccc(N)cc2C)n(CC)n1 |
| InChI | InChI=1S/C15H21N3O2S/c1-4-13-9-14(18(5-2)17-13)10-21(19,20)15-7-6-12(16)8-11(15)3/h6-9H,4-5,10,16H2,1-3H3 |
| InChIKey | SYPSZNCLAIWOAA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline?
The IUPAC name of 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline (CID 81184624) is 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline.
What is the SMILES notation for 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline?
The canonical SMILES for 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline is CCc1cc(CS(=O)(=O)c2ccc(N)cc2C)n(CC)n1.
What is the InChIKey of 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline?
The InChIKey is SYPSZNCLAIWOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2S/c1-4-13-9-14(18(5-2)17-13)10-21(19,20)15-7-6-12(16)8-11(15)3/h6-9H,4-5,10,16H2,1-3H3.
What are the key properties of 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline?
4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline has a molecular weight of 307.42 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]-3-methylaniline is sourced from PubChem (CID 81184624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).