C15H16BrNO2S — CID 81185457
5-bromo-2-[(3,5-dimethylphenyl)methylsulfonyl]aniline (PubChem CID 81185457) has the molecular formula C15H16BrNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is 5-bromo-2-[(3,5-dimethylphenyl)methylsulfonyl]aniline.
| Compound Name | 5-bromo-2-[(3,5-dimethylphenyl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 81185457 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 5-bromo-2-[(3,5-dimethylphenyl)methylsulfonyl]aniline |
| SMILES | Cc1cc(C)cc(CS(=O)(=O)c2ccc(Br)cc2N)c1 |
| InChI | InChI=1S/C15H16BrNO2S/c1-10-5-11(2)7-12(6-10)9-20(18,19)15-4-3-13(16)8-14(15)17/h3-8H,9,17H2,1-2H3 |
| InChIKey | AAWNJNTVBRBFOC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|