C12H17FN2O4S — CID 81186724
2-(4-amino-3-fluorophenyl)sulfonyl-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 81186724) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-(4-amino-3-fluorophenyl)sulfonyl-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(4-amino-3-fluorophenyl)sulfonyl-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 81186724 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(4-amino-3-fluorophenyl)sulfonyl-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CS(=O)(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C12H17FN2O4S/c1-8(6-19-2)15-12(16)7-20(17,18)9-3-4-11(14)10(13)5-9/h3-5,8H,6-7,14H2,1-2H3,(H,15,16) |
| InChIKey | NBELKPXHBUNAQN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|