About 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine
2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine (PubChem CID 81186778) has the molecular formula C8H16F3NO2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine |
| PubChem CID | 81186778 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine |
| SMILES | CC(CN)S(=O)CCCOCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-7(5-12)15(13)4-2-3-14-6-8(9,10)11/h7H,2-6,12H2,1H3 |
| InChIKey | FUZDRXAMVQEQRN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine?
The IUPAC name of 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine (CID 81186778) is 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine.
What is the SMILES notation for 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine?
The canonical SMILES for 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine is CC(CN)S(=O)CCCOCC(F)(F)F.
What is the InChIKey of 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine?
The InChIKey is FUZDRXAMVQEQRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2S/c1-7(5-12)15(13)4-2-3-14-6-8(9,10)11/h7H,2-6,12H2,1H3.
What are the key properties of 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine?
2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine has a molecular weight of 247.28 g/mol, XLogP of 1.05, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]propan-1-amine is sourced from PubChem (CID 81186778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).