C12H18N2O3S — CID 81187980
2-(1-aminopropan-2-ylsulfonyl)-N-(2-methylphenyl)acetamide (PubChem CID 81187980) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylsulfonyl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(1-aminopropan-2-ylsulfonyl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 81187980 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(1-aminopropan-2-ylsulfonyl)-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CS(=O)(=O)C(C)CN |
| InChI | InChI=1S/C12H18N2O3S/c1-9-5-3-4-6-11(9)14-12(15)8-18(16,17)10(2)7-13/h3-6,10H,7-8,13H2,1-2H3,(H,14,15) |
| InChIKey | AQLSIKVTXYVHJN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |