About 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine
2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine (PubChem CID 81188101) has the molecular formula C11H21N3O2S
and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine |
| PubChem CID | 81188101 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine |
| SMILES | CCc1cc(CS(=O)(=O)C(C)CN)n(CC)n1 |
| InChI | InChI=1S/C11H21N3O2S/c1-4-10-6-11(14(5-2)13-10)8-17(15,16)9(3)7-12/h6,9H,4-5,7-8,12H2,1-3H3 |
| InChIKey | RYPXMWSFZLOEDF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine?
The IUPAC name of 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine (CID 81188101) is 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine.
What is the SMILES notation for 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine?
The canonical SMILES for 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine is CCc1cc(CS(=O)(=O)C(C)CN)n(CC)n1.
What is the InChIKey of 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine?
The InChIKey is RYPXMWSFZLOEDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2S/c1-4-10-6-11(14(5-2)13-10)8-17(15,16)9(3)7-12/h6,9H,4-5,7-8,12H2,1-3H3.
What are the key properties of 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine?
2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine has a molecular weight of 259.37 g/mol, XLogP of 0.73, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-diethylpyrazol-5-yl)methylsulfonyl]propan-1-amine is sourced from PubChem (CID 81188101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).