C14H23NOS — CID 81188470
1-[(2,4,6-trimethylphenyl)methylsulfinyl]butan-2-amine (PubChem CID 81188470) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-[(2,4,6-trimethylphenyl)methylsulfinyl]butan-2-amine.
| Compound Name | 1-[(2,4,6-trimethylphenyl)methylsulfinyl]butan-2-amine |
|---|---|
| PubChem CID | 81188470 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-[(2,4,6-trimethylphenyl)methylsulfinyl]butan-2-amine |
| SMILES | CCC(N)CS(=O)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H23NOS/c1-5-13(15)8-17(16)9-14-11(3)6-10(2)7-12(14)4/h6-7,13H,5,8-9,15H2,1-4H3 |
| InChIKey | NJNVTKRRWBNOOV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |