About 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine
2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine (PubChem CID 81188539) has the molecular formula C7H14F3NOS
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine.
Molecular Properties
| Compound Name | 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine |
| PubChem CID | 81188539 |
| Molecular Formula | C7H14F3NOS |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine |
| SMILES | CC(C)(N)CS(=O)CCC(F)(F)F |
| InChI | InChI=1S/C7H14F3NOS/c1-6(2,11)5-13(12)4-3-7(8,9)10/h3-5,11H2,1-2H3 |
| InChIKey | NPGDGEBPWZCEDV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine?
The IUPAC name of 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine (CID 81188539) is 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine.
What is the SMILES notation for 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine?
The canonical SMILES for 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine is CC(C)(N)CS(=O)CCC(F)(F)F.
What is the InChIKey of 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine?
The InChIKey is NPGDGEBPWZCEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3NOS/c1-6(2,11)5-13(12)4-3-7(8,9)10/h3-5,11H2,1-2H3.
What are the key properties of 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine?
2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine has a molecular weight of 217.26 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(3,3,3-trifluoropropylsulfinyl)propan-2-amine is sourced from PubChem (CID 81188539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).