C11H15ClN2O2S — CID 81188971
2-(2-aminopropylsulfinyl)-N-(3-chlorophenyl)acetamide (PubChem CID 81188971) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-(2-aminopropylsulfinyl)-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(2-aminopropylsulfinyl)-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 81188971 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(2-aminopropylsulfinyl)-N-(3-chlorophenyl)acetamide |
| SMILES | CC(N)CS(=O)CC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-8(13)6-17(16)7-11(15)14-10-4-2-3-9(12)5-10/h2-5,8H,6-7,13H2,1H3,(H,14,15) |
| InChIKey | FMADTUUOYIMYBS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |