C12H19NO4S2 — CID 81189069
2-(3-ethylsulfonylpropylsulfonyl)-6-methylaniline (PubChem CID 81189069) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-(3-ethylsulfonylpropylsulfonyl)-6-methylaniline.
| Compound Name | 2-(3-ethylsulfonylpropylsulfonyl)-6-methylaniline |
|---|---|
| PubChem CID | 81189069 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(3-ethylsulfonylpropylsulfonyl)-6-methylaniline |
| SMILES | CCS(=O)(=O)CCCS(=O)(=O)c1cccc(C)c1N |
| InChI | InChI=1S/C12H19NO4S2/c1-3-18(14,15)8-5-9-19(16,17)11-7-4-6-10(2)12(11)13/h4,6-7H,3,5,8-9,13H2,1-2H3 |
| InChIKey | ZITVXMBFVLBBBE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|