C7H13F3N2O2S — CID 81189999
2-(2-aminopropylsulfinyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 81189999) has the molecular formula C7H13F3N2O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-(2-aminopropylsulfinyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2-aminopropylsulfinyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 81189999 |
| Molecular Formula | C7H13F3N2O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(2-aminopropylsulfinyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(N)CS(=O)CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O2S/c1-5(11)2-15(14)3-6(13)12-4-7(8,9)10/h5H,2-4,11H2,1H3,(H,12,13) |
| InChIKey | HAWPDZYUJVYXHC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |