C13H16N2O2S2 — CID 81190473
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfonyl]-2-methylaniline (PubChem CID 81190473) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfonyl]-2-methylaniline.
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfonyl]-2-methylaniline |
|---|---|
| PubChem CID | 81190473 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfonyl]-2-methylaniline |
| SMILES | Cc1nc(CS(=O)(=O)c2cccc(N)c2C)sc1C |
| InChI | InChI=1S/C13H16N2O2S2/c1-8-11(14)5-4-6-12(8)19(16,17)7-13-15-9(2)10(3)18-13/h4-6H,7,14H2,1-3H3 |
| InChIKey | BQAZKXCEMUUHGH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|