C12H14N2O2S2 — CID 81190784
4-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfonyl]aniline (PubChem CID 81190784) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfonyl]aniline.
| Compound Name | 4-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 81190784 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-methyl-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfonyl]aniline |
| SMILES | Cc1nc(CS(=O)(=O)c2cc(N)ccc2C)cs1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-8-3-4-10(13)5-12(8)18(15,16)7-11-6-17-9(2)14-11/h3-6H,7,13H2,1-2H3 |
| InChIKey | QGLJFRFWWAOOQH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|