C12H15FN4OS — CID 81193145
3-fluoro-4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylsulfinyl]aniline (PubChem CID 81193145) has the molecular formula C12H15FN4OS and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-fluoro-4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylsulfinyl]aniline.
| Compound Name | 3-fluoro-4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 81193145 |
| Molecular Formula | C12H15FN4OS |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-fluoro-4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylsulfinyl]aniline |
| SMILES | CC(C)n1ncnc1CS(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C12H15FN4OS/c1-8(2)17-12(15-7-16-17)6-19(18)11-4-3-9(14)5-10(11)13/h3-5,7-8H,6,14H2,1-2H3 |
| InChIKey | XMWQRLXHJHCRIC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|