About 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine
3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine (PubChem CID 81194093) has the molecular formula C8H16F3NO3S
and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine.
Molecular Properties
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine |
| PubChem CID | 81194093 |
| Molecular Formula | C8H16F3NO3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine |
| SMILES | CC(CCN)S(=O)(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO3S/c1-7(2-3-12)16(13,14)5-4-15-6-8(9,10)11/h7H,2-6,12H2,1H3 |
| InChIKey | KMYNSMCXDVXYRS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine?
The IUPAC name of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine (CID 81194093) is 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine.
What is the SMILES notation for 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine?
The canonical SMILES for 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine is CC(CCN)S(=O)(=O)CCOCC(F)(F)F.
What is the InChIKey of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine?
The InChIKey is KMYNSMCXDVXYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO3S/c1-7(2-3-12)16(13,14)5-4-15-6-8(9,10)11/h7H,2-6,12H2,1H3.
What are the key properties of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine?
3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine has a molecular weight of 263.28 g/mol, XLogP of 0.72, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]butan-1-amine is sourced from PubChem (CID 81194093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).