About 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine
4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine (PubChem CID 81194635) has the molecular formula C7H14F3NO2S
and a molecular weight of 233.25 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine.
Molecular Properties
| Compound Name | 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine |
| PubChem CID | 81194635 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine |
| SMILES | CC(N)CCS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S/c1-6(11)2-4-14(12,13)5-3-7(8,9)10/h6H,2-5,11H2,1H3 |
| InChIKey | SELKOIJVJHZKSR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine?
The IUPAC name of 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine (CID 81194635) is 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine.
What is the SMILES notation for 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine?
The canonical SMILES for 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine is CC(N)CCS(=O)(=O)CCC(F)(F)F.
What is the InChIKey of 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine?
The InChIKey is SELKOIJVJHZKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3NO2S/c1-6(11)2-4-14(12,13)5-3-7(8,9)10/h6H,2-5,11H2,1H3.
What are the key properties of 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine?
4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine has a molecular weight of 233.25 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3,3-trifluoropropylsulfonyl)butan-2-amine is sourced from PubChem (CID 81194635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).