C13H23N3O2S — CID 81195056
3-[(1-cyclopentylpyrazol-3-yl)methylsulfonyl]butan-1-amine (PubChem CID 81195056) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 3-[(1-cyclopentylpyrazol-3-yl)methylsulfonyl]butan-1-amine.
| Compound Name | 3-[(1-cyclopentylpyrazol-3-yl)methylsulfonyl]butan-1-amine |
|---|---|
| PubChem CID | 81195056 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[(1-cyclopentylpyrazol-3-yl)methylsulfonyl]butan-1-amine |
| SMILES | CC(CCN)S(=O)(=O)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C13H23N3O2S/c1-11(6-8-14)19(17,18)10-12-7-9-16(15-12)13-4-2-3-5-13/h7,9,11,13H,2-6,8,10,14H2,1H3 |
| InChIKey | NCNONRCEKYORIB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |