C11H15BrFNOS — CID 81195511
3-[(2-bromo-4-fluorophenyl)methylsulfinyl]butan-1-amine (PubChem CID 81195511) has the molecular formula C11H15BrFNOS and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-[(2-bromo-4-fluorophenyl)methylsulfinyl]butan-1-amine.
| Compound Name | 3-[(2-bromo-4-fluorophenyl)methylsulfinyl]butan-1-amine |
|---|---|
| PubChem CID | 81195511 |
| Molecular Formula | C11H15BrFNOS |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 3-[(2-bromo-4-fluorophenyl)methylsulfinyl]butan-1-amine |
| SMILES | CC(CCN)S(=O)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C11H15BrFNOS/c1-8(4-5-14)16(15)7-9-2-3-10(13)6-11(9)12/h2-3,6,8H,4-5,7,14H2,1H3 |
| InChIKey | MQHHMUYQXYPMER-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |