C18H36N2S — CID 81195715
2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]-2-propylpentane-1-thiol (PubChem CID 81195715) has the molecular formula C18H36N2S and a molecular weight of 312.57 g/mol. Its IUPAC name is 2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]-2-propylpentane-1-thiol.
| Compound Name | 2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]-2-propylpentane-1-thiol |
|---|---|
| PubChem CID | 81195715 |
| Molecular Formula | C18H36N2S |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]-2-propylpentane-1-thiol |
| SMILES | CCCC(CS)(CCC)CN1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C18H36N2S/c1-4-9-18(15-21,10-5-2)14-20-12-8-17-16(13-20)7-6-11-19(17)3/h16-17,21H,4-15H2,1-3H3 |
| InChIKey | KUAZAPYRYCRBRT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|