About 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine
4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine (PubChem CID 81195850) has the molecular formula C9H18F3NO3S
and a molecular weight of 277.31 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine.
Molecular Properties
| Compound Name | 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine |
| PubChem CID | 81195850 |
| Molecular Formula | C9H18F3NO3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine |
| SMILES | CC(N)CCS(=O)(=O)CCCOCC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO3S/c1-8(13)3-6-17(14,15)5-2-4-16-7-9(10,11)12/h8H,2-7,13H2,1H3 |
| InChIKey | LJZQLBGNXXXIFF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine?
The IUPAC name of 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine (CID 81195850) is 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine.
What is the SMILES notation for 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine?
The canonical SMILES for 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine is CC(N)CCS(=O)(=O)CCCOCC(F)(F)F.
What is the InChIKey of 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine?
The InChIKey is LJZQLBGNXXXIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO3S/c1-8(13)3-6-17(14,15)5-2-4-16-7-9(10,11)12/h8H,2-7,13H2,1H3.
What are the key properties of 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine?
4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine has a molecular weight of 277.31 g/mol, XLogP of 1.11, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]butan-2-amine is sourced from PubChem (CID 81195850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).