C15H20ClNO4 — CID 81196288
3-(2-chlorophenoxy)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propan-1-one (PubChem CID 81196288) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propan-1-one.
| Compound Name | 3-(2-chlorophenoxy)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 81196288 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(2-chlorophenoxy)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]propan-1-one |
| SMILES | CC1COC(CO)CN1C(=O)CCOc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO4/c1-11-10-21-12(9-18)8-17(11)15(19)6-7-20-14-5-3-2-4-13(14)16/h2-5,11-12,18H,6-10H2,1H3 |
| InChIKey | WRUPGVHYWZZPKD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |