About 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine
3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine (PubChem CID 81196450) has the molecular formula C8H14F3NO2S
and a molecular weight of 245.27 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine.
Molecular Properties
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine |
| PubChem CID | 81196450 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine |
| SMILES | O=S(CCOCC(F)(F)F)CC1CNC1 |
| InChI | InChI=1S/C8H14F3NO2S/c9-8(10,11)6-14-1-2-15(13)5-7-3-12-4-7/h7,12H,1-6H2 |
| InChIKey | CXXJWSPHMFSJKT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine?
The IUPAC name of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine (CID 81196450) is 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine.
What is the SMILES notation for 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine?
The canonical SMILES for 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine is O=S(CCOCC(F)(F)F)CC1CNC1.
What is the InChIKey of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine?
The InChIKey is CXXJWSPHMFSJKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2S/c9-8(10,11)6-14-1-2-15(13)5-7-3-12-4-7/h7,12H,1-6H2.
What are the key properties of 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine?
3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine has a molecular weight of 245.27 g/mol, XLogP of 0.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2,2-trifluoroethoxy)ethylsulfinylmethyl]azetidine is sourced from PubChem (CID 81196450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).