C17H23NO3 — CID 81196589
[2-(hydroxymethyl)morpholin-4-yl]-(1-phenylcyclopentyl)methanone (PubChem CID 81196589) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [2-(hydroxymethyl)morpholin-4-yl]-(1-phenylcyclopentyl)methanone.
| Compound Name | [2-(hydroxymethyl)morpholin-4-yl]-(1-phenylcyclopentyl)methanone |
|---|---|
| PubChem CID | 81196589 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [2-(hydroxymethyl)morpholin-4-yl]-(1-phenylcyclopentyl)methanone |
| SMILES | O=C(N1CCOC(CO)C1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H23NO3/c19-13-15-12-18(10-11-21-15)16(20)17(8-4-5-9-17)14-6-2-1-3-7-14/h1-3,6-7,15,19H,4-5,8-13H2 |
| InChIKey | RFLSZLXNTZTOKX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |