About 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine
3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine (PubChem CID 81197079) has the molecular formula C7H12F3NO2S
and a molecular weight of 231.24 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine.
Molecular Properties
| Compound Name | 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine |
| PubChem CID | 81197079 |
| Molecular Formula | C7H12F3NO2S |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine |
| SMILES | O=S(=O)(CCC(F)(F)F)CC1CNC1 |
| InChI | InChI=1S/C7H12F3NO2S/c8-7(9,10)1-2-14(12,13)5-6-3-11-4-6/h6,11H,1-5H2 |
| InChIKey | MWVPVAKZKCXCMO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine?
The IUPAC name of 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine (CID 81197079) is 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine.
What is the SMILES notation for 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine?
The canonical SMILES for 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine is O=S(=O)(CCC(F)(F)F)CC1CNC1.
What is the InChIKey of 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine?
The InChIKey is MWVPVAKZKCXCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO2S/c8-7(9,10)1-2-14(12,13)5-6-3-11-4-6/h6,11H,1-5H2.
What are the key properties of 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine?
3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine has a molecular weight of 231.24 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3,3-trifluoropropylsulfonylmethyl)azetidine is sourced from PubChem (CID 81197079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).