C15H21NO5 — CID 81197403
1-[2-(hydroxymethyl)morpholin-4-yl]-2-(2-methoxy-4-methylphenoxy)ethanone (PubChem CID 81197403) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)morpholin-4-yl]-2-(2-methoxy-4-methylphenoxy)ethanone.
| Compound Name | 1-[2-(hydroxymethyl)morpholin-4-yl]-2-(2-methoxy-4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 81197403 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[2-(hydroxymethyl)morpholin-4-yl]-2-(2-methoxy-4-methylphenoxy)ethanone |
| SMILES | COc1cc(C)ccc1OCC(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C15H21NO5/c1-11-3-4-13(14(7-11)19-2)21-10-15(18)16-5-6-20-12(8-16)9-17/h3-4,7,12,17H,5-6,8-10H2,1-2H3 |
| InChIKey | LDWVEZMHKMSKON-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |