C10H7F6NO — CID 81197834
2,6-bis(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 81197834) has the molecular formula C10H7F6NO and a molecular weight of 271.16 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2,6-bis(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 81197834 |
| Molecular Formula | C10H7F6NO |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2,6-bis(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | FC(F)(F)c1ccc2c(c1)NCC(C(F)(F)F)O2 |
| InChI | InChI=1S/C10H7F6NO/c11-9(12,13)5-1-2-7-6(3-5)17-4-8(18-7)10(14,15)16/h1-3,8,17H,4H2 |
| InChIKey | WLMFMLIQCDQSTM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |