About 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine
3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine (PubChem CID 81198059) has the molecular formula C9H16F3NO2S
and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine.
Molecular Properties
| Compound Name | 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine |
| PubChem CID | 81198059 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine |
| SMILES | O=S(CCCOCC(F)(F)F)CC1CNC1 |
| InChI | InChI=1S/C9H16F3NO2S/c10-9(11,12)7-15-2-1-3-16(14)6-8-4-13-5-8/h8,13H,1-7H2 |
| InChIKey | YYFZKTPSVNHMGE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine?
The IUPAC name of 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine (CID 81198059) is 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine.
What is the SMILES notation for 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine?
The canonical SMILES for 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine is O=S(CCCOCC(F)(F)F)CC1CNC1.
What is the InChIKey of 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine?
The InChIKey is YYFZKTPSVNHMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2S/c10-9(11,12)7-15-2-1-3-16(14)6-8-4-13-5-8/h8,13H,1-7H2.
What are the key properties of 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine?
3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine has a molecular weight of 259.29 g/mol, XLogP of 0.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,2,2-trifluoroethoxy)propylsulfinylmethyl]azetidine is sourced from PubChem (CID 81198059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).