C16H24ClN3 — CID 81198314
[2-chloro-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine (PubChem CID 81198314) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is [2-chloro-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine.
| Compound Name | [2-chloro-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 81198314 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [2-chloro-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine |
| SMILES | CN1CCCC2CN(c3cccc(Cl)c3CN)CCC21 |
| InChI | InChI=1S/C16H24ClN3/c1-19-8-3-4-12-11-20(9-7-15(12)19)16-6-2-5-14(17)13(16)10-18/h2,5-6,12,15H,3-4,7-11,18H2,1H3 |
| InChIKey | ZBWAKEYGJSSKEZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |